C15H22F8N2O — CID 162586471
2-methyl-N-[2,2,3,3,4,4,5,5-octafluoro-6-(3-methylbut-3-en-2-ylamino)hexyl]propanamide (PubChem CID 162586471) has the molecular formula C15H22F8N2O and a molecular weight of 398.34 g/mol. Its IUPAC name is 2-methyl-N-[2,2,3,3,4,4,5,5-octafluoro-6-(3-methylbut-3-en-2-ylamino)hexyl]propanamide.
| Compound Name | 2-methyl-N-[2,2,3,3,4,4,5,5-octafluoro-6-(3-methylbut-3-en-2-ylamino)hexyl]propanamide |
|---|---|
| PubChem CID | 162586471 |
| Molecular Formula | C15H22F8N2O |
| Molecular Weight | 398.34 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | 2-methyl-N-[2,2,3,3,4,4,5,5-octafluoro-6-(3-methylbut-3-en-2-ylamino)hexyl]propanamide |
| SMILES | C=C(C)C(C)NCC(F)(F)C(F)(F)C(F)(F)C(F)(F)CNC(=O)C(C)C |
| InChI | InChI=1S/C15H22F8N2O/c1-8(2)10(5)24-6-12(16,17)14(20,21)15(22,23)13(18,19)7-25-11(26)9(3)4/h9-10,24H,1,6-7H2,2-5H3,(H,25,26) |
| InChIKey | UGEWLLXAHAHKMX-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.34 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|