C11H19P — CID 167202874
[(1Z)-2-tert-butyl-3-methylidenepenta-1,4-dienyl]-methylphosphane (PubChem CID 167202874) has the molecular formula C11H19P and a molecular weight of 182.25 g/mol. Its IUPAC name is [(1Z)-2-tert-butyl-3-methylidenepenta-1,4-dienyl]-methylphosphane.
| Compound Name | [(1Z)-2-tert-butyl-3-methylidenepenta-1,4-dienyl]-methylphosphane |
|---|---|
| PubChem CID | 167202874 |
| Molecular Formula | C11H19P |
| Molecular Weight | 182.25 g/mol |
| Exact Mass | 182.12 |
| IUPAC Name | [(1Z)-2-tert-butyl-3-methylidenepenta-1,4-dienyl]-methylphosphane |
| SMILES | C=CC(=C)/C(=C\PC)C(C)(C)C |
| InChI | InChI=1S/C11H19P/c1-7-9(2)10(8-12-6)11(3,4)5/h7-8,12H,1-2H2,3-6H3/b10-8+ |
| InChIKey | RIZIWMNVWIJJPG-CSKARUKUSA-N |
| XLogP | 3.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.25 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|