C9H13F2OP — CID 142531243
[difluoro-[(4Z)-2-methylhepta-2,4,6-trien-3-yl]oxymethyl]phosphane (PubChem CID 142531243) has the molecular formula C9H13F2OP and a molecular weight of 206.17 g/mol. Its IUPAC name is [difluoro-[(4Z)-2-methylhepta-2,4,6-trien-3-yl]oxymethyl]phosphane.
| Compound Name | [difluoro-[(4Z)-2-methylhepta-2,4,6-trien-3-yl]oxymethyl]phosphane |
|---|---|
| PubChem CID | 142531243 |
| Molecular Formula | C9H13F2OP |
| Molecular Weight | 206.17 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | [difluoro-[(4Z)-2-methylhepta-2,4,6-trien-3-yl]oxymethyl]phosphane |
| SMILES | C=C/C=C\C(OC(F)(F)P)=C(C)C |
| InChI | InChI=1S/C9H13F2OP/c1-4-5-6-8(7(2)3)12-9(10,11)13/h4-6H,1,13H2,2-3H3/b6-5- |
| InChIKey | SMYIGPFDNKEIAZ-WAYWQWQTSA-N |
| XLogP | 3.46 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.17 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|