About 2-[[(3Z)-3-formylhexa-1,3,5-trien-2-yl]disulfanyl]benzaldehyde
2-[[(3Z)-3-formylhexa-1,3,5-trien-2-yl]disulfanyl]benzaldehyde (PubChem CID 143612775) has the molecular formula C14H12O2S2
and a molecular weight of 276.38 g/mol. Its IUPAC name is 2-[[(3Z)-3-formylhexa-1,3,5-trien-2-yl]disulfanyl]benzaldehyde.
Molecular Properties
| Compound Name | 2-[[(3Z)-3-formylhexa-1,3,5-trien-2-yl]disulfanyl]benzaldehyde |
| PubChem CID | 143612775 |
| Molecular Formula | C14H12O2S2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.03 |
| IUPAC Name | 2-[[(3Z)-3-formylhexa-1,3,5-trien-2-yl]disulfanyl]benzaldehyde |
| SMILES | C=C/C=C(/C=O)C(=C)SSc1ccccc1C=O |
| InChI | InChI=1S/C14H12O2S2/c1-3-6-12(9-15)11(2)17-18-14-8-5-4-7-13(14)10-16/h3-10H,1-2H2/b12-6- |
| InChIKey | VWPSCVIHPMZZJB-SDQBBNPISA-N |
| XLogP | 4.06 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-[[(3Z)-3-formylhexa-1,3,5-trien-2-yl]disulfanyl]benzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(3Z)-3-formylhexa-1,3,5-trien-2-yl]disulfanyl]benzaldehyde?
The IUPAC name of 2-[[(3Z)-3-formylhexa-1,3,5-trien-2-yl]disulfanyl]benzaldehyde (CID 143612775) is 2-[[(3Z)-3-formylhexa-1,3,5-trien-2-yl]disulfanyl]benzaldehyde.
What is the SMILES notation for 2-[[(3Z)-3-formylhexa-1,3,5-trien-2-yl]disulfanyl]benzaldehyde?
The canonical SMILES for 2-[[(3Z)-3-formylhexa-1,3,5-trien-2-yl]disulfanyl]benzaldehyde is C=C/C=C(/C=O)C(=C)SSc1ccccc1C=O.
What is the InChIKey of 2-[[(3Z)-3-formylhexa-1,3,5-trien-2-yl]disulfanyl]benzaldehyde?
The InChIKey is VWPSCVIHPMZZJB-SDQBBNPISA-N. The full InChI is InChI=1S/C14H12O2S2/c1-3-6-12(9-15)11(2)17-18-14-8-5-4-7-13(14)10-16/h3-10H,1-2H2/b12-6-.
What are the key properties of 2-[[(3Z)-3-formylhexa-1,3,5-trien-2-yl]disulfanyl]benzaldehyde?
2-[[(3Z)-3-formylhexa-1,3,5-trien-2-yl]disulfanyl]benzaldehyde has a molecular weight of 276.38 g/mol, XLogP of 4.06, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(3Z)-3-formylhexa-1,3,5-trien-2-yl]disulfanyl]benzaldehyde is sourced from PubChem (CID 143612775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).