C14H12O2S2 — CID 143612775
2-[[(3Z)-3-formylhexa-1,3,5-trien-2-yl]disulfanyl]benzaldehyde (PubChem CID 143612775) has the molecular formula C14H12O2S2 and a molecular weight of 276.38 g/mol. Its IUPAC name is 2-[[(3Z)-3-formylhexa-1,3,5-trien-2-yl]disulfanyl]benzaldehyde.
| Compound Name | 2-[[(3Z)-3-formylhexa-1,3,5-trien-2-yl]disulfanyl]benzaldehyde |
|---|---|
| PubChem CID | 143612775 |
| Molecular Formula | C14H12O2S2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.03 |
| IUPAC Name | 2-[[(3Z)-3-formylhexa-1,3,5-trien-2-yl]disulfanyl]benzaldehyde |
| SMILES | C=C/C=C(/C=O)C(=C)SSc1ccccc1C=O |
| InChI | InChI=1S/C14H12O2S2/c1-3-6-12(9-15)11(2)17-18-14-8-5-4-7-13(14)10-16/h3-10H,1-2H2/b12-6- |
| InChIKey | VWPSCVIHPMZZJB-SDQBBNPISA-N |
| XLogP | 4.06 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|