C20H32O2 — CID 173441738
3,7-dimethyl-9-(2,2,6-trimethylcyclohexylidene)nona-2,4,6-triene-1,8-diol (PubChem CID 173441738) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is 3,7-dimethyl-9-(2,2,6-trimethylcyclohexylidene)nona-2,4,6-triene-1,8-diol.
| Compound Name | 3,7-dimethyl-9-(2,2,6-trimethylcyclohexylidene)nona-2,4,6-triene-1,8-diol |
|---|---|
| PubChem CID | 173441738 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | 3,7-dimethyl-9-(2,2,6-trimethylcyclohexylidene)nona-2,4,6-triene-1,8-diol |
| SMILES | CC(C=CC=C(C)C(O)C=C1C(C)CCCC1(C)C)=CCO |
| InChI | InChI=1S/C20H32O2/c1-15(11-13-21)8-6-9-17(3)19(22)14-18-16(2)10-7-12-20(18,4)5/h6,8-9,11,14,16,19,21-22H,7,10,12-13H2,1-5H3 |
| InChIKey | ZBORQKBINAWKLI-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|