C15H24O — CID 54102571
2-ethoxy-6,10-dimethylundeca-2,4,6,9-tetraene (PubChem CID 54102571) has the molecular formula C15H24O and a molecular weight of 220.36 g/mol. Its IUPAC name is 2-ethoxy-6,10-dimethylundeca-2,4,6,9-tetraene.
| Compound Name | 2-ethoxy-6,10-dimethylundeca-2,4,6,9-tetraene |
|---|---|
| PubChem CID | 54102571 |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | 2-ethoxy-6,10-dimethylundeca-2,4,6,9-tetraene |
| SMILES | CCOC(C)=CC=CC(C)=CCC=C(C)C |
| InChI | InChI=1S/C15H24O/c1-6-16-15(5)12-8-11-14(4)10-7-9-13(2)3/h8-12H,6-7H2,1-5H3 |
| InChIKey | NBNOQANSTXBKMX-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|