C12H19NO2 — CID 89311713
ethyl 2-[(2E,4Z)-6-methylhepta-2,4,6-trien-2-yl]oxyethanimidate (PubChem CID 89311713) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is ethyl 2-[(2E,4Z)-6-methylhepta-2,4,6-trien-2-yl]oxyethanimidate.
| Compound Name | ethyl 2-[(2E,4Z)-6-methylhepta-2,4,6-trien-2-yl]oxyethanimidate |
|---|---|
| PubChem CID | 89311713 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | ethyl 2-[(2E,4Z)-6-methylhepta-2,4,6-trien-2-yl]oxyethanimidate |
| SMILES | [H]/N=C(/CO/C(C)=C/C=C\C(=C)C)OCC |
| InChI | InChI=1S/C12H19NO2/c1-5-14-12(13)9-15-11(4)8-6-7-10(2)3/h6-8,13H,2,5,9H2,1,3-4H3/b7-6-,11-8+,13-12- |
| InChIKey | WFLLDMZWNUMVFI-LTMPMBIPSA-N |
| XLogP | 3.05 |
| TPSA | 42.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|