C12H21OP — CID 123983884
1-(5-ethoxyhexa-2,4-dien-2-yl)phospholane (PubChem CID 123983884) has the molecular formula C12H21OP and a molecular weight of 212.27 g/mol. Its IUPAC name is 1-(5-ethoxyhexa-2,4-dien-2-yl)phospholane.
| Compound Name | 1-(5-ethoxyhexa-2,4-dien-2-yl)phospholane |
|---|---|
| PubChem CID | 123983884 |
| Molecular Formula | C12H21OP |
| Molecular Weight | 212.27 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | 1-(5-ethoxyhexa-2,4-dien-2-yl)phospholane |
| SMILES | CCOC(C)=CC=C(C)P1CCCC1 |
| InChI | InChI=1S/C12H21OP/c1-4-13-11(2)7-8-12(3)14-9-5-6-10-14/h7-8H,4-6,9-10H2,1-3H3 |
| InChIKey | IUFYSSADOUVOLM-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.27 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|