About cyclohexane;N,N-dimethylmethanamine;ethyl acetate
cyclohexane;N,N-dimethylmethanamine;ethyl acetate (PubChem CID 166691993) has the molecular formula C13H29NO2
and a molecular weight of 231.38 g/mol. Its IUPAC name is cyclohexane;N,N-dimethylmethanamine;ethyl acetate.
Molecular Properties
| Compound Name | cyclohexane;N,N-dimethylmethanamine;ethyl acetate |
| PubChem CID | 166691993 |
| Molecular Formula | C13H29NO2 |
| Molecular Weight | 231.38 g/mol |
| Exact Mass | 231.22 |
| IUPAC Name | cyclohexane;N,N-dimethylmethanamine;ethyl acetate |
| SMILES | C1CCCCC1.CCOC(C)=O.CN(C)C |
| InChI | InChI=1S/C6H12.C4H8O2.C3H9N/c1-2-4-6-5-3-1;1-3-6-4(2)5;1-4(2)3/h1-6H2;3H2,1-2H3;1-3H3 |
| InChIKey | ASGQIGYXLPRNAM-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.38 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cyclohexane;N,N-dimethylmethanamine;ethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexane;N,N-dimethylmethanamine;ethyl acetate?
The IUPAC name of cyclohexane;N,N-dimethylmethanamine;ethyl acetate (CID 166691993) is cyclohexane;N,N-dimethylmethanamine;ethyl acetate.
What is the SMILES notation for cyclohexane;N,N-dimethylmethanamine;ethyl acetate?
The canonical SMILES for cyclohexane;N,N-dimethylmethanamine;ethyl acetate is C1CCCCC1.CCOC(C)=O.CN(C)C.
What is the InChIKey of cyclohexane;N,N-dimethylmethanamine;ethyl acetate?
The InChIKey is ASGQIGYXLPRNAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12.C4H8O2.C3H9N/c1-2-4-6-5-3-1;1-3-6-4(2)5;1-4(2)3/h1-6H2;3H2,1-2H3;1-3H3.
What are the key properties of cyclohexane;N,N-dimethylmethanamine;ethyl acetate?
cyclohexane;N,N-dimethylmethanamine;ethyl acetate has a molecular weight of 231.38 g/mol, XLogP of 3.09, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexane;N,N-dimethylmethanamine;ethyl acetate is sourced from PubChem (CID 166691993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).