C11H20O — CID 137395501
(2E,5E)-2-ethoxy-6-methylocta-2,5-diene (PubChem CID 137395501) has the molecular formula C11H20O and a molecular weight of 168.28 g/mol. Its IUPAC name is (2E,5E)-2-ethoxy-6-methylocta-2,5-diene.
| Compound Name | (2E,5E)-2-ethoxy-6-methylocta-2,5-diene |
|---|---|
| PubChem CID | 137395501 |
| Molecular Formula | C11H20O |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.15 |
| IUPAC Name | (2E,5E)-2-ethoxy-6-methylocta-2,5-diene |
| SMILES | CCO/C(C)=C/C/C=C(\C)CC |
| InChI | InChI=1S/C11H20O/c1-5-10(3)8-7-9-11(4)12-6-2/h8-9H,5-7H2,1-4H3/b10-8+,11-9+ |
| InChIKey | UQQXSLMIJLVHCD-GFULKKFKSA-N |
| XLogP | 3.67 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|