C10H18O — CID 142244448
(2Z,5Z)-1-methoxy-6-methylocta-2,5-diene (PubChem CID 142244448) has the molecular formula C10H18O and a molecular weight of 154.25 g/mol. Its IUPAC name is (2Z,5Z)-1-methoxy-6-methylocta-2,5-diene.
| Compound Name | (2Z,5Z)-1-methoxy-6-methylocta-2,5-diene |
|---|---|
| PubChem CID | 142244448 |
| Molecular Formula | C10H18O |
| Molecular Weight | 154.25 g/mol |
| Exact Mass | 154.14 |
| IUPAC Name | (2Z,5Z)-1-methoxy-6-methylocta-2,5-diene |
| SMILES | CC/C(C)=C\C/C=C\COC |
| InChI | InChI=1S/C10H18O/c1-4-10(2)8-6-5-7-9-11-3/h5,7-8H,4,6,9H2,1-3H3/b7-5-,10-8- |
| InChIKey | ONIAWJUITNIKLC-RRMOSLQNSA-N |
| XLogP | 2.94 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.25 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|