C22H40O2 — CID 158027409
(2E,5E)-2-ethoxy-6-methylocta-2,5-diene;(5E)-2-ethoxy-6-methylocta-1,5-diene (PubChem CID 158027409) has the molecular formula C22H40O2 and a molecular weight of 336.56 g/mol. Its IUPAC name is (2E,5E)-2-ethoxy-6-methylocta-2,5-diene;(5E)-2-ethoxy-6-methylocta-1,5-diene.
| Compound Name | (2E,5E)-2-ethoxy-6-methylocta-2,5-diene;(5E)-2-ethoxy-6-methylocta-1,5-diene |
|---|---|
| PubChem CID | 158027409 |
| Molecular Formula | C22H40O2 |
| Molecular Weight | 336.56 g/mol |
| Exact Mass | 336.30 |
| IUPAC Name | (2E,5E)-2-ethoxy-6-methylocta-2,5-diene;(5E)-2-ethoxy-6-methylocta-1,5-diene |
| SMILES | C=C(CC/C=C(\C)CC)OCC.CCO/C(C)=C/C/C=C(\C)CC |
| InChI | InChI=1S/2C11H20O/c2*1-5-10(3)8-7-9-11(4)12-6-2/h8-9H,5-7H2,1-4H3;8H,4-7,9H2,1-3H3/b10-8+,11-9+;10-8+ |
| InChIKey | FGTOADQBRMRYKQ-BZGDPHELSA-N |
| XLogP | 7.35 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.56 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|