C10H15NO — CID 87946005
(1E,3E)-3,7-dimethyl-1-nitrosoocta-1,3,6-triene (PubChem CID 87946005) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is (1E,3E)-3,7-dimethyl-1-nitrosoocta-1,3,6-triene.
| Compound Name | (1E,3E)-3,7-dimethyl-1-nitrosoocta-1,3,6-triene |
|---|---|
| PubChem CID | 87946005 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | (1E,3E)-3,7-dimethyl-1-nitrosoocta-1,3,6-triene |
| SMILES | CC(C)=CC/C=C(C)/C=C/N=O |
| InChI | InChI=1S/C10H15NO/c1-9(2)5-4-6-10(3)7-8-11-12/h5-8H,4H2,1-3H3/b8-7+,10-6+ |
| InChIKey | QRWUVQWIBRMGNG-IQXTZUCASA-N |
| XLogP | 3.57 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|