About 3-methylbut-2-en-1-ol;hydrate
3-methylbut-2-en-1-ol;hydrate (PubChem CID 172859141) has the molecular formula C5H12O2
and a molecular weight of 104.15 g/mol. Its IUPAC name is 3-methylbut-2-en-1-ol;hydrate.
Molecular Properties
| Compound Name | 3-methylbut-2-en-1-ol;hydrate |
| PubChem CID | 172859141 |
| Molecular Formula | C5H12O2 |
| Molecular Weight | 104.15 g/mol |
| Exact Mass | 104.08 |
| IUPAC Name | 3-methylbut-2-en-1-ol;hydrate |
| SMILES | CC(C)=CCO.O |
| InChI | InChI=1S/C5H10O.H2O/c1-5(2)3-4-6;/h3,6H,4H2,1-2H3;1H2 |
| InChIKey | OTMAIVLGZHQSGL-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 51.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 104.15 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-methylbut-2-en-1-ol;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbut-2-en-1-ol;hydrate?
The IUPAC name of 3-methylbut-2-en-1-ol;hydrate (CID 172859141) is 3-methylbut-2-en-1-ol;hydrate.
What is the SMILES notation for 3-methylbut-2-en-1-ol;hydrate?
The canonical SMILES for 3-methylbut-2-en-1-ol;hydrate is CC(C)=CCO.O.
What is the InChIKey of 3-methylbut-2-en-1-ol;hydrate?
The InChIKey is OTMAIVLGZHQSGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O.H2O/c1-5(2)3-4-6;/h3,6H,4H2,1-2H3;1H2.
What are the key properties of 3-methylbut-2-en-1-ol;hydrate?
3-methylbut-2-en-1-ol;hydrate has a molecular weight of 104.15 g/mol, XLogP of 0.12, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbut-2-en-1-ol;hydrate is sourced from PubChem (CID 172859141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).