About (Z)-4,4,4-trideuterio-3-methylbut-2-en-1-ol
(Z)-4,4,4-trideuterio-3-methylbut-2-en-1-ol (PubChem CID 25240200) has the molecular formula C5H10O
and a molecular weight of 89.15 g/mol. Its IUPAC name is (Z)-4,4,4-trideuterio-3-methylbut-2-en-1-ol.
Molecular Properties
| Compound Name | (Z)-4,4,4-trideuterio-3-methylbut-2-en-1-ol |
| PubChem CID | 25240200 |
| Molecular Formula | C5H10O |
| Molecular Weight | 89.15 g/mol |
| Exact Mass | 89.09 |
| IUPAC Name | (Z)-4,4,4-trideuterio-3-methylbut-2-en-1-ol |
| SMILES | [2H]C([2H])([2H])/C(C)=C\CO |
| InChI | InChI=1S/C5H10O/c1-5(2)3-4-6/h3,6H,4H2,1-2H3/i1D3/b5-3+ |
| InChIKey | ASUAYTHWZCLXAN-ZFBBTTEKSA-N |
| XLogP | 0.94 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 89.15 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-4,4,4-trideuterio-3-methylbut-2-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-4,4,4-trideuterio-3-methylbut-2-en-1-ol?
The IUPAC name of (Z)-4,4,4-trideuterio-3-methylbut-2-en-1-ol (CID 25240200) is (Z)-4,4,4-trideuterio-3-methylbut-2-en-1-ol.
What is the SMILES notation for (Z)-4,4,4-trideuterio-3-methylbut-2-en-1-ol?
The canonical SMILES for (Z)-4,4,4-trideuterio-3-methylbut-2-en-1-ol is [2H]C([2H])([2H])/C(C)=C\CO.
What is the InChIKey of (Z)-4,4,4-trideuterio-3-methylbut-2-en-1-ol?
The InChIKey is ASUAYTHWZCLXAN-ZFBBTTEKSA-N. The full InChI is InChI=1S/C5H10O/c1-5(2)3-4-6/h3,6H,4H2,1-2H3/i1D3/b5-3+.
What are the key properties of (Z)-4,4,4-trideuterio-3-methylbut-2-en-1-ol?
(Z)-4,4,4-trideuterio-3-methylbut-2-en-1-ol has a molecular weight of 89.15 g/mol, XLogP of 0.94, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-4,4,4-trideuterio-3-methylbut-2-en-1-ol is sourced from PubChem (CID 25240200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).