About disodium;2-[2-(2,5-dioxopyrrolidin-1-yl)ethyl]butanedioate
disodium;2-[2-(2,5-dioxopyrrolidin-1-yl)ethyl]butanedioate (PubChem CID 10266048) has the molecular formula C10H11NNa2O6
and a molecular weight of 287.18 g/mol. Its IUPAC name is disodium;2-[2-(2,5-dioxopyrrolidin-1-yl)ethyl]butanedioate.
Molecular Properties
| Compound Name | disodium;2-[2-(2,5-dioxopyrrolidin-1-yl)ethyl]butanedioate |
| PubChem CID | 10266048 |
| Molecular Formula | C10H11NNa2O6 |
| Molecular Weight | 287.18 g/mol |
| Exact Mass | 287.04 |
| IUPAC Name | disodium;2-[2-(2,5-dioxopyrrolidin-1-yl)ethyl]butanedioate |
| SMILES | O=C([O-])CC(CCN1C(=O)CCC1=O)C(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C10H13NO6.2Na/c12-7-1-2-8(13)11(7)4-3-6(10(16)17)5-9(14)15;;/h6H,1-5H2,(H,14,15)(H,16,17);;/q;2*+1/p-2 |
| InChIKey | LRBPAWONMLIAPM-UHFFFAOYSA-L |
| XLogP | -8.96 |
| TPSA | 117.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.18 |
| LogP ≤ 5 | -8.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze disodium;2-[2-(2,5-dioxopyrrolidin-1-yl)ethyl]butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;2-[2-(2,5-dioxopyrrolidin-1-yl)ethyl]butanedioate?
The IUPAC name of disodium;2-[2-(2,5-dioxopyrrolidin-1-yl)ethyl]butanedioate (CID 10266048) is disodium;2-[2-(2,5-dioxopyrrolidin-1-yl)ethyl]butanedioate.
What is the SMILES notation for disodium;2-[2-(2,5-dioxopyrrolidin-1-yl)ethyl]butanedioate?
The canonical SMILES for disodium;2-[2-(2,5-dioxopyrrolidin-1-yl)ethyl]butanedioate is O=C([O-])CC(CCN1C(=O)CCC1=O)C(=O)[O-].[Na+].[Na+].
What is the InChIKey of disodium;2-[2-(2,5-dioxopyrrolidin-1-yl)ethyl]butanedioate?
The InChIKey is LRBPAWONMLIAPM-UHFFFAOYSA-L. The full InChI is InChI=1S/C10H13NO6.2Na/c12-7-1-2-8(13)11(7)4-3-6(10(16)17)5-9(14)15;;/h6H,1-5H2,(H,14,15)(H,16,17);;/q;2*+1/p-2.
What are the key properties of disodium;2-[2-(2,5-dioxopyrrolidin-1-yl)ethyl]butanedioate?
disodium;2-[2-(2,5-dioxopyrrolidin-1-yl)ethyl]butanedioate has a molecular weight of 287.18 g/mol, XLogP of -8.96, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;2-[2-(2,5-dioxopyrrolidin-1-yl)ethyl]butanedioate is sourced from PubChem (CID 10266048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).