About 2-[bis(2,5-dioxopyrrolidin-1-yl)methyl]-2-methylpropanedioic acid
2-[bis(2,5-dioxopyrrolidin-1-yl)methyl]-2-methylpropanedioic acid (PubChem CID 118208289) has the molecular formula C13H14N2O8
and a molecular weight of 326.26 g/mol. Its IUPAC name is 2-[bis(2,5-dioxopyrrolidin-1-yl)methyl]-2-methylpropanedioic acid.
Molecular Properties
| Compound Name | 2-[bis(2,5-dioxopyrrolidin-1-yl)methyl]-2-methylpropanedioic acid |
| PubChem CID | 118208289 |
| Molecular Formula | C13H14N2O8 |
| Molecular Weight | 326.26 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | 2-[bis(2,5-dioxopyrrolidin-1-yl)methyl]-2-methylpropanedioic acid |
| SMILES | CC(C(=O)O)(C(=O)O)C(N1C(=O)CCC1=O)N1C(=O)CCC1=O |
| InChI | InChI=1S/C13H14N2O8/c1-13(11(20)21,12(22)23)10(14-6(16)2-3-7(14)17)15-8(18)4-5-9(15)19/h10H,2-5H2,1H3,(H,20,21)(H,22,23) |
| InChIKey | IUKHQPSJCOCSCT-UHFFFAOYSA-N |
| XLogP | -1.21 |
| TPSA | 149.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.26 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-[bis(2,5-dioxopyrrolidin-1-yl)methyl]-2-methylpropanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[bis(2,5-dioxopyrrolidin-1-yl)methyl]-2-methylpropanedioic acid?
The IUPAC name of 2-[bis(2,5-dioxopyrrolidin-1-yl)methyl]-2-methylpropanedioic acid (CID 118208289) is 2-[bis(2,5-dioxopyrrolidin-1-yl)methyl]-2-methylpropanedioic acid.
What is the SMILES notation for 2-[bis(2,5-dioxopyrrolidin-1-yl)methyl]-2-methylpropanedioic acid?
The canonical SMILES for 2-[bis(2,5-dioxopyrrolidin-1-yl)methyl]-2-methylpropanedioic acid is CC(C(=O)O)(C(=O)O)C(N1C(=O)CCC1=O)N1C(=O)CCC1=O.
What is the InChIKey of 2-[bis(2,5-dioxopyrrolidin-1-yl)methyl]-2-methylpropanedioic acid?
The InChIKey is IUKHQPSJCOCSCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2O8/c1-13(11(20)21,12(22)23)10(14-6(16)2-3-7(14)17)15-8(18)4-5-9(15)19/h10H,2-5H2,1H3,(H,20,21)(H,22,23).
What are the key properties of 2-[bis(2,5-dioxopyrrolidin-1-yl)methyl]-2-methylpropanedioic acid?
2-[bis(2,5-dioxopyrrolidin-1-yl)methyl]-2-methylpropanedioic acid has a molecular weight of 326.26 g/mol, XLogP of -1.21, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[bis(2,5-dioxopyrrolidin-1-yl)methyl]-2-methylpropanedioic acid is sourced from PubChem (CID 118208289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).