C10H12ClNO3 — CID 86594965
2-(2,5-dioxopyrrol-1-yl)hexanoyl chloride (PubChem CID 86594965) has the molecular formula C10H12ClNO3 and a molecular weight of 229.66 g/mol. Its IUPAC name is 2-(2,5-dioxopyrrol-1-yl)hexanoyl chloride.
| Compound Name | 2-(2,5-dioxopyrrol-1-yl)hexanoyl chloride |
|---|---|
| PubChem CID | 86594965 |
| Molecular Formula | C10H12ClNO3 |
| Molecular Weight | 229.66 g/mol |
| Exact Mass | 229.05 |
| IUPAC Name | 2-(2,5-dioxopyrrol-1-yl)hexanoyl chloride |
| SMILES | CCCCC(C(=O)Cl)N1C(=O)C=CC1=O |
| InChI | InChI=1S/C10H12ClNO3/c1-2-3-4-7(10(11)15)12-8(13)5-6-9(12)14/h5-7H,2-4H2,1H3 |
| InChIKey | URRSAPYMNBDNRH-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.66 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|