C20H29N3O4 — CID 22722392
1-[1-[1-(2,5-dioxopyrrol-1-yl)hexylamino]hexyl]pyrrole-2,5-dione (PubChem CID 22722392) has the molecular formula C20H29N3O4 and a molecular weight of 375.47 g/mol. Its IUPAC name is 1-[1-[1-(2,5-dioxopyrrol-1-yl)hexylamino]hexyl]pyrrole-2,5-dione.
| Compound Name | 1-[1-[1-(2,5-dioxopyrrol-1-yl)hexylamino]hexyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 22722392 |
| Molecular Formula | C20H29N3O4 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | 1-[1-[1-(2,5-dioxopyrrol-1-yl)hexylamino]hexyl]pyrrole-2,5-dione |
| SMILES | CCCCCC(NC(CCCCC)N1C(=O)C=CC1=O)N1C(=O)C=CC1=O |
| InChI | InChI=1S/C20H29N3O4/c1-3-5-7-9-15(22-17(24)11-12-18(22)25)21-16(10-8-6-4-2)23-19(26)13-14-20(23)27/h11-16,21H,3-10H2,1-2H3 |
| InChIKey | BYWPCKFRWVQQMA-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|