C18H25CaNO6 — CID 66635943
calcium;2-(2,5-dioxopyrrol-1-yl)undecanoate;prop-2-enoate (PubChem CID 66635943) has the molecular formula C18H25CaNO6 and a molecular weight of 391.48 g/mol. Its IUPAC name is calcium;2-(2,5-dioxopyrrol-1-yl)undecanoate;prop-2-enoate.
| Compound Name | calcium;2-(2,5-dioxopyrrol-1-yl)undecanoate;prop-2-enoate |
|---|---|
| PubChem CID | 66635943 |
| Molecular Formula | C18H25CaNO6 |
| Molecular Weight | 391.48 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | calcium;2-(2,5-dioxopyrrol-1-yl)undecanoate;prop-2-enoate |
| SMILES | C=CC(=O)[O-].CCCCCCCCCC(C(=O)[O-])N1C(=O)C=CC1=O.[Ca+2] |
| InChI | InChI=1S/C15H23NO4.C3H4O2.Ca/c1-2-3-4-5-6-7-8-9-12(15(19)20)16-13(17)10-11-14(16)18;1-2-3(4)5;/h10-12H,2-9H2,1H3,(H,19,20);2H,1H2,(H,4,5);/q;;+2/p-2 |
| InChIKey | CFUJTGXUKPCBRY-UHFFFAOYSA-L |
| XLogP | -0.29 |
| TPSA | 117.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.48 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|