C9H12N4O4S — CID 88636841
N-diazo-1-(2,5-dioxopyrrol-1-yl)pentane-1-sulfonamide (PubChem CID 88636841) has the molecular formula C9H12N4O4S and a molecular weight of 272.29 g/mol. Its IUPAC name is N-diazo-1-(2,5-dioxopyrrol-1-yl)pentane-1-sulfonamide.
| Compound Name | N-diazo-1-(2,5-dioxopyrrol-1-yl)pentane-1-sulfonamide |
|---|---|
| PubChem CID | 88636841 |
| Molecular Formula | C9H12N4O4S |
| Molecular Weight | 272.29 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | N-diazo-1-(2,5-dioxopyrrol-1-yl)pentane-1-sulfonamide |
| SMILES | CCCCC(N1C(=O)C=CC1=O)S(=O)(=O)N=[N+]=[N-] |
| InChI | InChI=1S/C9H12N4O4S/c1-2-3-4-9(18(16,17)12-11-10)13-7(14)5-6-8(13)15/h5-6,9H,2-4H2,1H3 |
| InChIKey | GMFMEUZFMQPOGD-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 120.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.29 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|