2-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)hexanoic acid

C12H17NO4 — CID 19591320

IUPAC2-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)hexanoic acid
SMILESCCCCC(C(=O)O)N1C(=O)C(C)=C(C)C1=O
InChIInChI=1S/C12H17NO4/c1-4-5-6-9(12(16)17)13-10(14)7(2)8(3)11(13)15/h9H,4-6H2,1-3H3,(H,16,17)
InChIKeyCCWWPXMUDICTQY-UHFFFAOYSA-N
MW239.27 g/mol
LogP1.34
Rot. Bonds5

About 2-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)hexanoic acid

2-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)hexanoic acid (PubChem CID 19591320) has the molecular formula C12H17NO4 and a molecular weight of 239.27 g/mol. Its IUPAC name is 2-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)hexanoic acid.

Molecular Properties

Compound Name2-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)hexanoic acid
PubChem CID19591320
Molecular FormulaC12H17NO4
Molecular Weight239.27 g/mol
Exact Mass239.12
IUPAC Name2-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)hexanoic acid
SMILESCCCCC(C(=O)O)N1C(=O)C(C)=C(C)C1=O
InChIInChI=1S/C12H17NO4/c1-4-5-6-9(12(16)17)13-10(14)7(2)8(3)11(13)15/h9H,4-6H2,1-3H3,(H,16,17)
InChIKeyCCWWPXMUDICTQY-UHFFFAOYSA-N
XLogP1.34
TPSA74.68 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500239.27
LogP ≤ 51.34
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phthalimide', 'substructure': 'N/A'}

Analyze 2-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)hexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)hexanoic acid?
The IUPAC name of 2-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)hexanoic acid (CID 19591320) is 2-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)hexanoic acid.
What is the SMILES notation for 2-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)hexanoic acid?
The canonical SMILES for 2-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)hexanoic acid is CCCCC(C(=O)O)N1C(=O)C(C)=C(C)C1=O.
What is the InChIKey of 2-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)hexanoic acid?
The InChIKey is CCWWPXMUDICTQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO4/c1-4-5-6-9(12(16)17)13-10(14)7(2)8(3)11(13)15/h9H,4-6H2,1-3H3,(H,16,17).
What are the key properties of 2-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)hexanoic acid?
2-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)hexanoic acid has a molecular weight of 239.27 g/mol, XLogP of 1.34, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)hexanoic acid is sourced from PubChem (CID 19591320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).