2-(1,3-dioxo-2-azaspiro[4.6]undecan-2-yl)hexanoic acid

C16H25NO4 — CID 43470102

IUPAC2-(1,3-dioxo-2-azaspiro[4.6]undecan-2-yl)hexanoic acid
SMILESCCCCC(C(=O)O)N1C(=O)CC2(CCCCCC2)C1=O
InChIInChI=1S/C16H25NO4/c1-2-3-8-12(14(19)20)17-13(18)11-16(15(17)21)9-6-4-5-7-10-16/h12H,2-11H2,1H3,(H,19,20)
InChIKeyDMPVVPVWYIIUDJ-UHFFFAOYSA-N
MW295.38 g/mol
LogP2.73
Rot. Bonds5

About 2-(1,3-dioxo-2-azaspiro[4.6]undecan-2-yl)hexanoic acid

2-(1,3-dioxo-2-azaspiro[4.6]undecan-2-yl)hexanoic acid (PubChem CID 43470102) has the molecular formula C16H25NO4 and a molecular weight of 295.38 g/mol. Its IUPAC name is 2-(1,3-dioxo-2-azaspiro[4.6]undecan-2-yl)hexanoic acid.

Molecular Properties

Compound Name2-(1,3-dioxo-2-azaspiro[4.6]undecan-2-yl)hexanoic acid
PubChem CID43470102
Molecular FormulaC16H25NO4
Molecular Weight295.38 g/mol
Exact Mass295.18
IUPAC Name2-(1,3-dioxo-2-azaspiro[4.6]undecan-2-yl)hexanoic acid
SMILESCCCCC(C(=O)O)N1C(=O)CC2(CCCCCC2)C1=O
InChIInChI=1S/C16H25NO4/c1-2-3-8-12(14(19)20)17-13(18)11-16(15(17)21)9-6-4-5-7-10-16/h12H,2-11H2,1H3,(H,19,20)
InChIKeyDMPVVPVWYIIUDJ-UHFFFAOYSA-N
XLogP2.73
TPSA74.68 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500295.38
LogP ≤ 52.73
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phthalimide', 'substructure': 'N/A'}

Analyze 2-(1,3-dioxo-2-azaspiro[4.6]undecan-2-yl)hexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1,3-dioxo-2-azaspiro[4.6]undecan-2-yl)hexanoic acid?
The IUPAC name of 2-(1,3-dioxo-2-azaspiro[4.6]undecan-2-yl)hexanoic acid (CID 43470102) is 2-(1,3-dioxo-2-azaspiro[4.6]undecan-2-yl)hexanoic acid.
What is the SMILES notation for 2-(1,3-dioxo-2-azaspiro[4.6]undecan-2-yl)hexanoic acid?
The canonical SMILES for 2-(1,3-dioxo-2-azaspiro[4.6]undecan-2-yl)hexanoic acid is CCCCC(C(=O)O)N1C(=O)CC2(CCCCCC2)C1=O.
What is the InChIKey of 2-(1,3-dioxo-2-azaspiro[4.6]undecan-2-yl)hexanoic acid?
The InChIKey is DMPVVPVWYIIUDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25NO4/c1-2-3-8-12(14(19)20)17-13(18)11-16(15(17)21)9-6-4-5-7-10-16/h12H,2-11H2,1H3,(H,19,20).
What are the key properties of 2-(1,3-dioxo-2-azaspiro[4.6]undecan-2-yl)hexanoic acid?
2-(1,3-dioxo-2-azaspiro[4.6]undecan-2-yl)hexanoic acid has a molecular weight of 295.38 g/mol, XLogP of 2.73, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-dioxo-2-azaspiro[4.6]undecan-2-yl)hexanoic acid is sourced from PubChem (CID 43470102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).