C16H25NO4 — CID 43470102
2-(1,3-dioxo-2-azaspiro[4.6]undecan-2-yl)hexanoic acid (PubChem CID 43470102) has the molecular formula C16H25NO4 and a molecular weight of 295.38 g/mol. Its IUPAC name is 2-(1,3-dioxo-2-azaspiro[4.6]undecan-2-yl)hexanoic acid.
| Compound Name | 2-(1,3-dioxo-2-azaspiro[4.6]undecan-2-yl)hexanoic acid |
|---|---|
| PubChem CID | 43470102 |
| Molecular Formula | C16H25NO4 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | 2-(1,3-dioxo-2-azaspiro[4.6]undecan-2-yl)hexanoic acid |
| SMILES | CCCCC(C(=O)O)N1C(=O)CC2(CCCCCC2)C1=O |
| InChI | InChI=1S/C16H25NO4/c1-2-3-8-12(14(19)20)17-13(18)11-16(15(17)21)9-6-4-5-7-10-16/h12H,2-11H2,1H3,(H,19,20) |
| InChIKey | DMPVVPVWYIIUDJ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|