C20H22N2O8S2 — CID 68620304
2-[11-(1-carboxypentyl)-4,6,10,12-tetraoxo-2,8-dithia-5,11-diazatricyclo[7.3.0.03,7]dodeca-1(9),3(7)-dien-5-yl]hexanoic acid (PubChem CID 68620304) has the molecular formula C20H22N2O8S2 and a molecular weight of 482.54 g/mol. Its IUPAC name is 2-[11-(1-carboxypentyl)-4,6,10,12-tetraoxo-2,8-dithia-5,11-diazatricyclo[7.3.0.03,7]dodeca-1(9),3(7)-dien-5-yl]hexanoic acid.
| Compound Name | 2-[11-(1-carboxypentyl)-4,6,10,12-tetraoxo-2,8-dithia-5,11-diazatricyclo[7.3.0.03,7]dodeca-1(9),3(7)-dien-5-yl]hexanoic acid |
|---|---|
| PubChem CID | 68620304 |
| Molecular Formula | C20H22N2O8S2 |
| Molecular Weight | 482.54 g/mol |
| Exact Mass | 482.08 |
| IUPAC Name | 2-[11-(1-carboxypentyl)-4,6,10,12-tetraoxo-2,8-dithia-5,11-diazatricyclo[7.3.0.03,7]dodeca-1(9),3(7)-dien-5-yl]hexanoic acid |
| SMILES | CCCCC(C(=O)O)n1c(=O)c2sc3c(=O)n(C(CCCC)C(=O)O)c(=O)c3sc2c1=O |
| InChI | InChI=1S/C20H22N2O8S2/c1-3-5-7-9(19(27)28)21-15(23)11-12(16(21)24)32-14-13(31-11)17(25)22(18(14)26)10(20(29)30)8-6-4-2/h9-10H,3-8H2,1-2H3,(H,27,28)(H,29,30) |
| InChIKey | LWXDZZCCJVQIHZ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 152.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.54 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |