C18H27N3O9 — CID 139846064
2-[3,5-bis(1-carboxybutyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]pentanoic acid (PubChem CID 139846064) has the molecular formula C18H27N3O9 and a molecular weight of 429.43 g/mol. Its IUPAC name is 2-[3,5-bis(1-carboxybutyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]pentanoic acid.
| Compound Name | 2-[3,5-bis(1-carboxybutyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]pentanoic acid |
|---|---|
| PubChem CID | 139846064 |
| Molecular Formula | C18H27N3O9 |
| Molecular Weight | 429.43 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | 2-[3,5-bis(1-carboxybutyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]pentanoic acid |
| SMILES | CCCC(C(=O)O)n1c(=O)n(C(CCC)C(=O)O)c(=O)n(C(CCC)C(=O)O)c1=O |
| InChI | InChI=1S/C18H27N3O9/c1-4-7-10(13(22)23)19-16(28)20(11(8-5-2)14(24)25)18(30)21(17(19)29)12(9-6-3)15(26)27/h10-12H,4-9H2,1-3H3,(H,22,23)(H,24,25)(H,26,27) |
| InChIKey | UQLLOVOVUFNBGT-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 177.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.43 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |