C14H21N3O4 — CID 121290189
1-[4-[[(4S)-4-amino-5-oxohexyl]amino]-3-oxobutyl]pyrrole-2,5-dione (PubChem CID 121290189) has the molecular formula C14H21N3O4 and a molecular weight of 295.34 g/mol. Its IUPAC name is 1-[4-[[(4S)-4-amino-5-oxohexyl]amino]-3-oxobutyl]pyrrole-2,5-dione.
| Compound Name | 1-[4-[[(4S)-4-amino-5-oxohexyl]amino]-3-oxobutyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 121290189 |
| Molecular Formula | C14H21N3O4 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | 1-[4-[[(4S)-4-amino-5-oxohexyl]amino]-3-oxobutyl]pyrrole-2,5-dione |
| SMILES | CC(=O)[C@@H](N)CCCNCC(=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C14H21N3O4/c1-10(18)12(15)3-2-7-16-9-11(19)6-8-17-13(20)4-5-14(17)21/h4-5,12,16H,2-3,6-9,15H2,1H3/t12-/m0/s1 |
| InChIKey | QSOMCDQZSKWPGQ-LBPRGKRZSA-N |
| XLogP | -0.84 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|