C16H26N2O3 — CID 145135132
1-[5-[[(2S)-2-acetyl-3-methylbutyl]amino]pentyl]pyrrole-2,5-dione (PubChem CID 145135132) has the molecular formula C16H26N2O3 and a molecular weight of 294.39 g/mol. Its IUPAC name is 1-[5-[[(2S)-2-acetyl-3-methylbutyl]amino]pentyl]pyrrole-2,5-dione.
| Compound Name | 1-[5-[[(2S)-2-acetyl-3-methylbutyl]amino]pentyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 145135132 |
| Molecular Formula | C16H26N2O3 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | 1-[5-[[(2S)-2-acetyl-3-methylbutyl]amino]pentyl]pyrrole-2,5-dione |
| SMILES | CC(=O)[C@H](CNCCCCCN1C(=O)C=CC1=O)C(C)C |
| InChI | InChI=1S/C16H26N2O3/c1-12(2)14(13(3)19)11-17-9-5-4-6-10-18-15(20)7-8-16(18)21/h7-8,12,14,17H,4-6,9-11H2,1-3H3/t14-/m1/s1 |
| InChIKey | HVGDXSBXAPQLIR-CQSZACIVSA-N |
| XLogP | 1.53 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|