C19H28N2O6S — CID 167653549
(2R)-2-[[(2S)-9-(2,5-dioxopyrrol-1-yl)-4-oxo-2-propan-2-ylnonanoyl]amino]-3-sulfanylpropanoic acid (PubChem CID 167653549) has the molecular formula C19H28N2O6S and a molecular weight of 412.51 g/mol. Its IUPAC name is (2R)-2-[[(2S)-9-(2,5-dioxopyrrol-1-yl)-4-oxo-2-propan-2-ylnonanoyl]amino]-3-sulfanylpropanoic acid.
| Compound Name | (2R)-2-[[(2S)-9-(2,5-dioxopyrrol-1-yl)-4-oxo-2-propan-2-ylnonanoyl]amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 167653549 |
| Molecular Formula | C19H28N2O6S |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | (2R)-2-[[(2S)-9-(2,5-dioxopyrrol-1-yl)-4-oxo-2-propan-2-ylnonanoyl]amino]-3-sulfanylpropanoic acid |
| SMILES | CC(C)[C@H](CC(=O)CCCCCN1C(=O)C=CC1=O)C(=O)N[C@@H](CS)C(=O)O |
| InChI | InChI=1S/C19H28N2O6S/c1-12(2)14(18(25)20-15(11-28)19(26)27)10-13(22)6-4-3-5-9-21-16(23)7-8-17(21)24/h7-8,12,14-15,28H,3-6,9-11H2,1-2H3,(H,20,25)(H,26,27)/t14-,15-/m0/s1 |
| InChIKey | JHUORQAKKJWPNP-GJZGRUSLSA-N |
| XLogP | 1.20 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|