C26H41N3O6 — CID 162139433
(2S)-N-[(4S)-9-amino-2-methyl-3,9-dioxononan-4-yl]-9-(2,5-dioxopyrrol-1-yl)-4-oxo-2-propan-2-ylnonanamide (PubChem CID 162139433) has the molecular formula C26H41N3O6 and a molecular weight of 491.63 g/mol. Its IUPAC name is (2S)-N-[(4S)-9-amino-2-methyl-3,9-dioxononan-4-yl]-9-(2,5-dioxopyrrol-1-yl)-4-oxo-2-propan-2-ylnonanamide.
| Compound Name | (2S)-N-[(4S)-9-amino-2-methyl-3,9-dioxononan-4-yl]-9-(2,5-dioxopyrrol-1-yl)-4-oxo-2-propan-2-ylnonanamide |
|---|---|
| PubChem CID | 162139433 |
| Molecular Formula | C26H41N3O6 |
| Molecular Weight | 491.63 g/mol |
| Exact Mass | 491.30 |
| IUPAC Name | (2S)-N-[(4S)-9-amino-2-methyl-3,9-dioxononan-4-yl]-9-(2,5-dioxopyrrol-1-yl)-4-oxo-2-propan-2-ylnonanamide |
| SMILES | CC(C)C(=O)[C@H](CCCCC(N)=O)NC(=O)[C@@H](CC(=O)CCCCCN1C(=O)C=CC1=O)C(C)C |
| InChI | InChI=1S/C26H41N3O6/c1-17(2)20(16-19(30)10-6-5-9-15-29-23(32)13-14-24(29)33)26(35)28-21(25(34)18(3)4)11-7-8-12-22(27)31/h13-14,17-18,20-21H,5-12,15-16H2,1-4H3,(H2,27,31)(H,28,35)/t20-,21-/m0/s1 |
| InChIKey | ZJSPELKEAFBYMW-SFTDATJTSA-N |
| XLogP | 2.46 |
| TPSA | 143.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.63 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|