C25H40N4O10 — CID 153023207
(2S)-5-(carbamoylamino)-2-[[(2S)-6-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]-4-oxo-2-propan-2-ylhexanoyl]amino]pentanoic acid (PubChem CID 153023207) has the molecular formula C25H40N4O10 and a molecular weight of 556.61 g/mol. Its IUPAC name is (2S)-5-(carbamoylamino)-2-[[(2S)-6-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]-4-oxo-2-propan-2-ylhexanoyl]amino]pentanoic acid.
| Compound Name | (2S)-5-(carbamoylamino)-2-[[(2S)-6-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]-4-oxo-2-propan-2-ylhexanoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 153023207 |
| Molecular Formula | C25H40N4O10 |
| Molecular Weight | 556.61 g/mol |
| Exact Mass | 556.27 |
| IUPAC Name | (2S)-5-(carbamoylamino)-2-[[(2S)-6-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]-4-oxo-2-propan-2-ylhexanoyl]amino]pentanoic acid |
| SMILES | CC(C)[C@H](CC(=O)CCOCCOCCOCCN1C(=O)C=CC1=O)C(=O)N[C@@H](CCCNC(N)=O)C(=O)O |
| InChI | InChI=1S/C25H40N4O10/c1-17(2)19(23(33)28-20(24(34)35)4-3-8-27-25(26)36)16-18(30)7-10-37-12-14-39-15-13-38-11-9-29-21(31)5-6-22(29)32/h5-6,17,19-20H,3-4,7-16H2,1-2H3,(H,28,33)(H,34,35)(H3,26,27,36)/t19-,20-/m0/s1 |
| InChIKey | VCILOBNDYZYXAX-PMACEKPBSA-N |
| XLogP | -0.40 |
| TPSA | 203.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.61 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|