2-amino-3-morpholin-4-ylpropanoic acid

C7H14N2O3 — CID 10634204

IUPAC2-amino-3-morpholin-4-ylpropanoic acid
SMILESNC(CN1CCOCC1)C(=O)O
InChIInChI=1S/C7H14N2O3/c8-6(7(10)11)5-9-1-3-12-4-2-9/h6H,1-5,8H2,(H,10,11)
InChIKeyXQBWWSOQRZVLPX-UHFFFAOYSA-N
MW174.20 g/mol
LogP-1.27
Rot. Bonds3

About 2-amino-3-morpholin-4-ylpropanoic acid

2-amino-3-morpholin-4-ylpropanoic acid (PubChem CID 10634204) has the molecular formula C7H14N2O3 and a molecular weight of 174.20 g/mol. Its IUPAC name is 2-amino-3-morpholin-4-ylpropanoic acid.

Molecular Properties

Compound Name2-amino-3-morpholin-4-ylpropanoic acid
PubChem CID10634204
Molecular FormulaC7H14N2O3
Molecular Weight174.20 g/mol
Exact Mass174.10
IUPAC Name2-amino-3-morpholin-4-ylpropanoic acid
SMILESNC(CN1CCOCC1)C(=O)O
InChIInChI=1S/C7H14N2O3/c8-6(7(10)11)5-9-1-3-12-4-2-9/h6H,1-5,8H2,(H,10,11)
InChIKeyXQBWWSOQRZVLPX-UHFFFAOYSA-N
XLogP-1.27
TPSA75.79 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500174.20
LogP ≤ 5-1.27
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-amino-3-morpholin-4-ylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-amino-4-methyl-1-morpholin-4-ylpentan-3-one
CID 83686496
2-amino-3-(4-methylpiperazin-1-yl)propanoic acid
CID 10611336
ethyl (2S)-2-amino-3-morpholin-4-ylpropanoate
CID 70159679
(2S)-2-amino-3-(4-oxopiperidin-1-yl)propanoic acid
CID 138475703
2-methyl-3-morpholin-4-ylpropanoic acid;hydrochloride
CID 6603192
2-amino-3-[4-(2-hydroxyethyl)piperazin-1-yl]propanoic acid
CID 65442051
(4S)-4-amino-5-morpholin-4-ylpentanoic acid
CID 97055085
2-(morpholin-4-ylmethyl)butanedioic acid
CID 45376163
2-amino-3-(4,4-dimethylpiperidin-1-yl)propanoic acid
CID 62932657
(2R)-2-amino-3-(4-phenylpiperazin-1-yl)propanoic acid
CID 177277413
4-[(2-amino-3-morpholin-4-ylpropanoyl)amino]butanoic acid
CID 123232497
(2S)-2-amino-4-[carboxy(morpholin-4-yl)amino]butanoic acid
CID 174670355

Frequently Asked Questions

What is the IUPAC name of 2-amino-3-morpholin-4-ylpropanoic acid?
The IUPAC name of 2-amino-3-morpholin-4-ylpropanoic acid (CID 10634204) is 2-amino-3-morpholin-4-ylpropanoic acid.
What is the SMILES notation for 2-amino-3-morpholin-4-ylpropanoic acid?
The canonical SMILES for 2-amino-3-morpholin-4-ylpropanoic acid is NC(CN1CCOCC1)C(=O)O.
What is the InChIKey of 2-amino-3-morpholin-4-ylpropanoic acid?
The InChIKey is XQBWWSOQRZVLPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2O3/c8-6(7(10)11)5-9-1-3-12-4-2-9/h6H,1-5,8H2,(H,10,11).
What are the key properties of 2-amino-3-morpholin-4-ylpropanoic acid?
2-amino-3-morpholin-4-ylpropanoic acid has a molecular weight of 174.20 g/mol, XLogP of -1.27, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-morpholin-4-ylpropanoic acid is sourced from PubChem (CID 10634204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).