C9H17N3O5 — CID 174670355
(2S)-2-amino-4-[carboxy(morpholin-4-yl)amino]butanoic acid (PubChem CID 174670355) has the molecular formula C9H17N3O5 and a molecular weight of 247.25 g/mol. Its IUPAC name is (2S)-2-amino-4-[carboxy(morpholin-4-yl)amino]butanoic acid.
| Compound Name | (2S)-2-amino-4-[carboxy(morpholin-4-yl)amino]butanoic acid |
|---|---|
| PubChem CID | 174670355 |
| Molecular Formula | C9H17N3O5 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | (2S)-2-amino-4-[carboxy(morpholin-4-yl)amino]butanoic acid |
| SMILES | N[C@@H](CCN(C(=O)O)N1CCOCC1)C(=O)O |
| InChI | InChI=1S/C9H17N3O5/c10-7(8(13)14)1-2-12(9(15)16)11-3-5-17-6-4-11/h7H,1-6,10H2,(H,13,14)(H,15,16)/t7-/m0/s1 |
| InChIKey | IIVSETDMBVDLCX-ZETCQYMHSA-N |
| XLogP | -0.98 |
| TPSA | 116.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |