C9H18N4O4 — CID 174670395
2-amino-4-[carboxy(piperazin-1-yl)amino]butanoic acid (PubChem CID 174670395) has the molecular formula C9H18N4O4 and a molecular weight of 246.27 g/mol. Its IUPAC name is 2-amino-4-[carboxy(piperazin-1-yl)amino]butanoic acid.
| Compound Name | 2-amino-4-[carboxy(piperazin-1-yl)amino]butanoic acid |
|---|---|
| PubChem CID | 174670395 |
| Molecular Formula | C9H18N4O4 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | 2-amino-4-[carboxy(piperazin-1-yl)amino]butanoic acid |
| SMILES | NC(CCN(C(=O)O)N1CCNCC1)C(=O)O |
| InChI | InChI=1S/C9H18N4O4/c10-7(8(14)15)1-4-13(9(16)17)12-5-2-11-3-6-12/h7,11H,1-6,10H2,(H,14,15)(H,16,17) |
| InChIKey | ZKNATQLFOFRYSG-UHFFFAOYSA-N |
| XLogP | -1.41 |
| TPSA | 119.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |