C10H20N4O4 — CID 67154957
2-amino-4-[carboxy-(4-methylpiperazin-1-yl)amino]butanoic acid (PubChem CID 67154957) has the molecular formula C10H20N4O4 and a molecular weight of 260.29 g/mol. Its IUPAC name is 2-amino-4-[carboxy-(4-methylpiperazin-1-yl)amino]butanoic acid.
| Compound Name | 2-amino-4-[carboxy-(4-methylpiperazin-1-yl)amino]butanoic acid |
|---|---|
| PubChem CID | 67154957 |
| Molecular Formula | C10H20N4O4 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | 2-amino-4-[carboxy-(4-methylpiperazin-1-yl)amino]butanoic acid |
| SMILES | CN1CCN(N(CCC(N)C(=O)O)C(=O)O)CC1 |
| InChI | InChI=1S/C10H20N4O4/c1-12-4-6-13(7-5-12)14(10(17)18)3-2-8(11)9(15)16/h8H,2-7,11H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | XOQZTGUDDPBBQT-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 110.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |