C9H20N4O4S — CID 70945316
2-amino-4-[(4-methylpiperazin-1-yl)sulfonylamino]butanoic acid (PubChem CID 70945316) has the molecular formula C9H20N4O4S and a molecular weight of 280.35 g/mol. Its IUPAC name is 2-amino-4-[(4-methylpiperazin-1-yl)sulfonylamino]butanoic acid.
| Compound Name | 2-amino-4-[(4-methylpiperazin-1-yl)sulfonylamino]butanoic acid |
|---|---|
| PubChem CID | 70945316 |
| Molecular Formula | C9H20N4O4S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 2-amino-4-[(4-methylpiperazin-1-yl)sulfonylamino]butanoic acid |
| SMILES | CN1CCN(S(=O)(=O)NCCC(N)C(=O)O)CC1 |
| InChI | InChI=1S/C9H20N4O4S/c1-12-4-6-13(7-5-12)18(16,17)11-3-2-8(10)9(14)15/h8,11H,2-7,10H2,1H3,(H,14,15) |
| InChIKey | IGPVKIKXIRJHTN-UHFFFAOYSA-N |
| XLogP | -2.13 |
| TPSA | 115.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | -2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |