C9H19N3O4S — CID 70945674
2-amino-4-(piperidin-1-ylsulfonylamino)butanoic acid (PubChem CID 70945674) has the molecular formula C9H19N3O4S and a molecular weight of 265.33 g/mol. Its IUPAC name is 2-amino-4-(piperidin-1-ylsulfonylamino)butanoic acid.
| Compound Name | 2-amino-4-(piperidin-1-ylsulfonylamino)butanoic acid |
|---|---|
| PubChem CID | 70945674 |
| Molecular Formula | C9H19N3O4S |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 2-amino-4-(piperidin-1-ylsulfonylamino)butanoic acid |
| SMILES | NC(CCNS(=O)(=O)N1CCCCC1)C(=O)O |
| InChI | InChI=1S/C9H19N3O4S/c10-8(9(13)14)4-5-11-17(15,16)12-6-2-1-3-7-12/h8,11H,1-7,10H2,(H,13,14) |
| InChIKey | LHQPIWLEPMAMFD-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |