C10H22N4O5S — CID 67154681
2-amino-3-[3-morpholin-4-ylpropyl(sulfamoyl)amino]propanoic acid (PubChem CID 67154681) has the molecular formula C10H22N4O5S and a molecular weight of 310.38 g/mol. Its IUPAC name is 2-amino-3-[3-morpholin-4-ylpropyl(sulfamoyl)amino]propanoic acid.
| Compound Name | 2-amino-3-[3-morpholin-4-ylpropyl(sulfamoyl)amino]propanoic acid |
|---|---|
| PubChem CID | 67154681 |
| Molecular Formula | C10H22N4O5S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | 2-amino-3-[3-morpholin-4-ylpropyl(sulfamoyl)amino]propanoic acid |
| SMILES | NC(CN(CCCN1CCOCC1)S(N)(=O)=O)C(=O)O |
| InChI | InChI=1S/C10H22N4O5S/c11-9(10(15)16)8-14(20(12,17)18)3-1-2-13-4-6-19-7-5-13/h9H,1-8,11H2,(H,15,16)(H2,12,17,18) |
| InChIKey | AAXKJOURWGWASR-UHFFFAOYSA-N |
| XLogP | -2.37 |
| TPSA | 139.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | -2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |