C10H21N3O5S — CID 70945469
2-amino-3-(3-morpholin-4-ylpropylsulfamoyl)propanoic acid (PubChem CID 70945469) has the molecular formula C10H21N3O5S and a molecular weight of 295.36 g/mol. Its IUPAC name is 2-amino-3-(3-morpholin-4-ylpropylsulfamoyl)propanoic acid.
| Compound Name | 2-amino-3-(3-morpholin-4-ylpropylsulfamoyl)propanoic acid |
|---|---|
| PubChem CID | 70945469 |
| Molecular Formula | C10H21N3O5S |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 2-amino-3-(3-morpholin-4-ylpropylsulfamoyl)propanoic acid |
| SMILES | NC(CS(=O)(=O)NCCCN1CCOCC1)C(=O)O |
| InChI | InChI=1S/C10H21N3O5S/c11-9(10(14)15)8-19(16,17)12-2-1-3-13-4-6-18-7-5-13/h9,12H,1-8,11H2,(H,14,15) |
| InChIKey | IIPFSUCIXILGCS-UHFFFAOYSA-N |
| XLogP | -1.96 |
| TPSA | 121.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | -1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|