C7H18N4O4S — CID 87289653
2-amino-3-[2-(dimethylamino)ethyl-sulfamoylamino]propanoic acid (PubChem CID 87289653) has the molecular formula C7H18N4O4S and a molecular weight of 254.31 g/mol. Its IUPAC name is 2-amino-3-[2-(dimethylamino)ethyl-sulfamoylamino]propanoic acid.
| Compound Name | 2-amino-3-[2-(dimethylamino)ethyl-sulfamoylamino]propanoic acid |
|---|---|
| PubChem CID | 87289653 |
| Molecular Formula | C7H18N4O4S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.10 |
| IUPAC Name | 2-amino-3-[2-(dimethylamino)ethyl-sulfamoylamino]propanoic acid |
| SMILES | CN(C)CCN(CC(N)C(=O)O)S(N)(=O)=O |
| InChI | InChI=1S/C7H18N4O4S/c1-10(2)3-4-11(16(9,14)15)5-6(8)7(12)13/h6H,3-5,8H2,1-2H3,(H,12,13)(H2,9,14,15) |
| InChIKey | GDYOLHVLXYRSKL-UHFFFAOYSA-N |
| XLogP | -2.53 |
| TPSA | 129.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | -2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |