C7H15N3O4S — CID 174670463
(2S)-2-amino-4-[cyclopropyl(sulfamoyl)amino]butanoic acid (PubChem CID 174670463) has the molecular formula C7H15N3O4S and a molecular weight of 237.28 g/mol. Its IUPAC name is (2S)-2-amino-4-[cyclopropyl(sulfamoyl)amino]butanoic acid.
| Compound Name | (2S)-2-amino-4-[cyclopropyl(sulfamoyl)amino]butanoic acid |
|---|---|
| PubChem CID | 174670463 |
| Molecular Formula | C7H15N3O4S |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | (2S)-2-amino-4-[cyclopropyl(sulfamoyl)amino]butanoic acid |
| SMILES | N[C@@H](CCN(C1CC1)S(N)(=O)=O)C(=O)O |
| InChI | InChI=1S/C7H15N3O4S/c8-6(7(11)12)3-4-10(5-1-2-5)15(9,13)14/h5-6H,1-4,8H2,(H,11,12)(H2,9,13,14)/t6-/m0/s1 |
| InChIKey | MVQRNVWOPGUPFU-LURJTMIESA-N |
| XLogP | -1.54 |
| TPSA | 126.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |