C9H20N4O4S — CID 67154841
2-amino-3-[piperidin-4-ylmethyl(sulfamoyl)amino]propanoic acid (PubChem CID 67154841) has the molecular formula C9H20N4O4S and a molecular weight of 280.35 g/mol. Its IUPAC name is 2-amino-3-[piperidin-4-ylmethyl(sulfamoyl)amino]propanoic acid.
| Compound Name | 2-amino-3-[piperidin-4-ylmethyl(sulfamoyl)amino]propanoic acid |
|---|---|
| PubChem CID | 67154841 |
| Molecular Formula | C9H20N4O4S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 2-amino-3-[piperidin-4-ylmethyl(sulfamoyl)amino]propanoic acid |
| SMILES | NC(CN(CC1CCNCC1)S(N)(=O)=O)C(=O)O |
| InChI | InChI=1S/C9H20N4O4S/c10-8(9(14)15)6-13(18(11,16)17)5-7-1-3-12-4-2-7/h7-8,12H,1-6,10H2,(H,14,15)(H2,11,16,17) |
| InChIKey | LOSQUINHVPMDHW-UHFFFAOYSA-N |
| XLogP | -2.10 |
| TPSA | 138.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | -2.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |