C9H19N3O2S — CID 167049531
4-[cyclopropylmethyl(sulfamoyl)amino]piperidine (PubChem CID 167049531) has the molecular formula C9H19N3O2S and a molecular weight of 233.34 g/mol. Its IUPAC name is 4-[cyclopropylmethyl(sulfamoyl)amino]piperidine.
| Compound Name | 4-[cyclopropylmethyl(sulfamoyl)amino]piperidine |
|---|---|
| PubChem CID | 167049531 |
| Molecular Formula | C9H19N3O2S |
| Molecular Weight | 233.34 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | 4-[cyclopropylmethyl(sulfamoyl)amino]piperidine |
| SMILES | NS(=O)(=O)N(CC1CC1)C1CCNCC1 |
| InChI | InChI=1S/C9H19N3O2S/c10-15(13,14)12(7-8-1-2-8)9-3-5-11-6-4-9/h8-9,11H,1-7H2,(H2,10,13,14) |
| InChIKey | IBDALXZQFOEQSB-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.34 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |