C6H15N3O4S — CID 174670415
(2S)-2-amino-3-[propan-2-yl(sulfamoyl)amino]propanoic acid (PubChem CID 174670415) has the molecular formula C6H15N3O4S and a molecular weight of 225.27 g/mol. Its IUPAC name is (2S)-2-amino-3-[propan-2-yl(sulfamoyl)amino]propanoic acid.
| Compound Name | (2S)-2-amino-3-[propan-2-yl(sulfamoyl)amino]propanoic acid |
|---|---|
| PubChem CID | 174670415 |
| Molecular Formula | C6H15N3O4S |
| Molecular Weight | 225.27 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | (2S)-2-amino-3-[propan-2-yl(sulfamoyl)amino]propanoic acid |
| SMILES | CC(C)N(C[C@H](N)C(=O)O)S(N)(=O)=O |
| InChI | InChI=1S/C6H15N3O4S/c1-4(2)9(14(8,12)13)3-5(7)6(10)11/h4-5H,3,7H2,1-2H3,(H,10,11)(H2,8,12,13)/t5-/m0/s1 |
| InChIKey | FXACWWRVZNKDAK-YFKPBYRVSA-N |
| XLogP | -1.69 |
| TPSA | 126.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.27 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |