C5H9N3O2 — CID 134364923
2-amino-3-(1-methyldiazirin-3-yl)propanoic acid (PubChem CID 134364923) has the molecular formula C5H9N3O2 and a molecular weight of 143.15 g/mol. Its IUPAC name is 2-amino-3-(1-methyldiazirin-3-yl)propanoic acid.
| Compound Name | 2-amino-3-(1-methyldiazirin-3-yl)propanoic acid |
|---|---|
| PubChem CID | 134364923 |
| Molecular Formula | C5H9N3O2 |
| Molecular Weight | 143.15 g/mol |
| Exact Mass | 143.07 |
| IUPAC Name | 2-amino-3-(1-methyldiazirin-3-yl)propanoic acid |
| SMILES | CN1N=C1CC(N)C(=O)O |
| InChI | InChI=1S/C5H9N3O2/c1-8-4(7-8)2-3(6)5(9)10/h3H,2,6H2,1H3,(H,9,10) |
| InChIKey | ZDOHMIDRNJSOJY-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 78.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.15 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |