About 2-amino-3-(5-methoxy-1,3-dimethylpyrazol-4-yl)propanoic acid
2-amino-3-(5-methoxy-1,3-dimethylpyrazol-4-yl)propanoic acid (PubChem CID 82660664) has the molecular formula C9H15N3O3
and a molecular weight of 213.24 g/mol. Its IUPAC name is 2-amino-3-(5-methoxy-1,3-dimethylpyrazol-4-yl)propanoic acid.
Analyze 2-amino-3-(5-methoxy-1,3-dimethylpyrazol-4-yl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3-(5-methoxy-1,3-dimethylpyrazol-4-yl)propanoic acid?
The IUPAC name of 2-amino-3-(5-methoxy-1,3-dimethylpyrazol-4-yl)propanoic acid (CID 82660664) is 2-amino-3-(5-methoxy-1,3-dimethylpyrazol-4-yl)propanoic acid.
What is the SMILES notation for 2-amino-3-(5-methoxy-1,3-dimethylpyrazol-4-yl)propanoic acid?
The canonical SMILES for 2-amino-3-(5-methoxy-1,3-dimethylpyrazol-4-yl)propanoic acid is COc1c(CC(N)C(=O)O)c(C)nn1C.
What is the InChIKey of 2-amino-3-(5-methoxy-1,3-dimethylpyrazol-4-yl)propanoic acid?
The InChIKey is XYJFOMJCCNDTCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3O3/c1-5-6(4-7(10)9(13)14)8(15-3)12(2)11-5/h7H,4,10H2,1-3H3,(H,13,14).
What are the key properties of 2-amino-3-(5-methoxy-1,3-dimethylpyrazol-4-yl)propanoic acid?
2-amino-3-(5-methoxy-1,3-dimethylpyrazol-4-yl)propanoic acid has a molecular weight of 213.24 g/mol, XLogP of -0.31, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-(5-methoxy-1,3-dimethylpyrazol-4-yl)propanoic acid is sourced from PubChem (CID 82660664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).