C10H19N5O2 — CID 113463419
2-[(5-methoxy-1,3-dimethylpyrazol-4-yl)methylamino]ethylurea (PubChem CID 113463419) has the molecular formula C10H19N5O2 and a molecular weight of 241.29 g/mol. Its IUPAC name is 2-[(5-methoxy-1,3-dimethylpyrazol-4-yl)methylamino]ethylurea.
| Compound Name | 2-[(5-methoxy-1,3-dimethylpyrazol-4-yl)methylamino]ethylurea |
|---|---|
| PubChem CID | 113463419 |
| Molecular Formula | C10H19N5O2 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | 2-[(5-methoxy-1,3-dimethylpyrazol-4-yl)methylamino]ethylurea |
| SMILES | COc1c(CNCCNC(N)=O)c(C)nn1C |
| InChI | InChI=1S/C10H19N5O2/c1-7-8(9(17-3)15(2)14-7)6-12-4-5-13-10(11)16/h12H,4-6H2,1-3H3,(H3,11,13,16) |
| InChIKey | MWYOKZFOXFCXSP-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 94.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|