C14H19N3O2 — CID 115603366
2-[[(5-methoxy-1,3-dimethylpyrazol-4-yl)methylamino]methyl]phenol (PubChem CID 115603366) has the molecular formula C14H19N3O2 and a molecular weight of 261.32 g/mol. Its IUPAC name is 2-[[(5-methoxy-1,3-dimethylpyrazol-4-yl)methylamino]methyl]phenol.
| Compound Name | 2-[[(5-methoxy-1,3-dimethylpyrazol-4-yl)methylamino]methyl]phenol |
|---|---|
| PubChem CID | 115603366 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 2-[[(5-methoxy-1,3-dimethylpyrazol-4-yl)methylamino]methyl]phenol |
| SMILES | COc1c(CNCc2ccccc2O)c(C)nn1C |
| InChI | InChI=1S/C14H19N3O2/c1-10-12(14(19-3)17(2)16-10)9-15-8-11-6-4-5-7-13(11)18/h4-7,15,18H,8-9H2,1-3H3 |
| InChIKey | MYUWWELYTISMTB-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|