C15H21N3O2 — CID 78963860
4-methoxy-2-[[(1,3,5-trimethylpyrazol-4-yl)methylamino]methyl]phenol (PubChem CID 78963860) has the molecular formula C15H21N3O2 and a molecular weight of 275.35 g/mol. Its IUPAC name is 4-methoxy-2-[[(1,3,5-trimethylpyrazol-4-yl)methylamino]methyl]phenol.
| Compound Name | 4-methoxy-2-[[(1,3,5-trimethylpyrazol-4-yl)methylamino]methyl]phenol |
|---|---|
| PubChem CID | 78963860 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | 4-methoxy-2-[[(1,3,5-trimethylpyrazol-4-yl)methylamino]methyl]phenol |
| SMILES | COc1ccc(O)c(CNCc2c(C)nn(C)c2C)c1 |
| InChI | InChI=1S/C15H21N3O2/c1-10-14(11(2)18(3)17-10)9-16-8-12-7-13(20-4)5-6-15(12)19/h5-7,16,19H,8-9H2,1-4H3 |
| InChIKey | MGRLTCVMTIVDIO-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|