C15H21N3O — CID 112554596
2-methyl-6-[[(1,3,5-trimethylpyrazol-4-yl)methylamino]methyl]phenol (PubChem CID 112554596) has the molecular formula C15H21N3O and a molecular weight of 259.35 g/mol. Its IUPAC name is 2-methyl-6-[[(1,3,5-trimethylpyrazol-4-yl)methylamino]methyl]phenol.
| Compound Name | 2-methyl-6-[[(1,3,5-trimethylpyrazol-4-yl)methylamino]methyl]phenol |
|---|---|
| PubChem CID | 112554596 |
| Molecular Formula | C15H21N3O |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | 2-methyl-6-[[(1,3,5-trimethylpyrazol-4-yl)methylamino]methyl]phenol |
| SMILES | Cc1cccc(CNCc2c(C)nn(C)c2C)c1O |
| InChI | InChI=1S/C15H21N3O/c1-10-6-5-7-13(15(10)19)8-16-9-14-11(2)17-18(4)12(14)3/h5-7,16,19H,8-9H2,1-4H3 |
| InChIKey | NTBNEWKESGNRAF-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|