About methyl 2-amino-3-(1,3-dimethyl-5-morpholin-4-ylpyrazol-4-yl)propanoate
methyl 2-amino-3-(1,3-dimethyl-5-morpholin-4-ylpyrazol-4-yl)propanoate (PubChem CID 170883513) has the molecular formula C13H22N4O3
and a molecular weight of 282.34 g/mol. Its IUPAC name is methyl 2-amino-3-(1,3-dimethyl-5-morpholin-4-ylpyrazol-4-yl)propanoate.
Molecular Properties
| Compound Name | methyl 2-amino-3-(1,3-dimethyl-5-morpholin-4-ylpyrazol-4-yl)propanoate |
| PubChem CID | 170883513 |
| Molecular Formula | C13H22N4O3 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | methyl 2-amino-3-(1,3-dimethyl-5-morpholin-4-ylpyrazol-4-yl)propanoate |
| SMILES | COC(=O)C(N)Cc1c(C)nn(C)c1N1CCOCC1 |
| InChI | InChI=1S/C13H22N4O3/c1-9-10(8-11(14)13(18)19-3)12(16(2)15-9)17-4-6-20-7-5-17/h11H,4-8,14H2,1-3H3 |
| InChIKey | JTQUNLQRYGFOTO-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 2-amino-3-(1,3-dimethyl-5-morpholin-4-ylpyrazol-4-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-amino-3-(1,3-dimethyl-5-morpholin-4-ylpyrazol-4-yl)propanoate?
The IUPAC name of methyl 2-amino-3-(1,3-dimethyl-5-morpholin-4-ylpyrazol-4-yl)propanoate (CID 170883513) is methyl 2-amino-3-(1,3-dimethyl-5-morpholin-4-ylpyrazol-4-yl)propanoate.
What is the SMILES notation for methyl 2-amino-3-(1,3-dimethyl-5-morpholin-4-ylpyrazol-4-yl)propanoate?
The canonical SMILES for methyl 2-amino-3-(1,3-dimethyl-5-morpholin-4-ylpyrazol-4-yl)propanoate is COC(=O)C(N)Cc1c(C)nn(C)c1N1CCOCC1.
What is the InChIKey of methyl 2-amino-3-(1,3-dimethyl-5-morpholin-4-ylpyrazol-4-yl)propanoate?
The InChIKey is JTQUNLQRYGFOTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N4O3/c1-9-10(8-11(14)13(18)19-3)12(16(2)15-9)17-4-6-20-7-5-17/h11H,4-8,14H2,1-3H3.
What are the key properties of methyl 2-amino-3-(1,3-dimethyl-5-morpholin-4-ylpyrazol-4-yl)propanoate?
methyl 2-amino-3-(1,3-dimethyl-5-morpholin-4-ylpyrazol-4-yl)propanoate has a molecular weight of 282.34 g/mol, XLogP of -0.39, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-amino-3-(1,3-dimethyl-5-morpholin-4-ylpyrazol-4-yl)propanoate is sourced from PubChem (CID 170883513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).